CAS 2005454-12-4 appears in our catalog under these names: PD1-PDL1-IN 1, 98%, PD1–PDL1–IN 1, PD1-PDL1-IN 1. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, Get quote.
(2S,3R)-2-[[(1S)-3-amino-3-oxo-1-(3-piperazin-1-yl-1,2,4-oxadiazol-5-yl)propyl]carbamoylamino]-3-hydroxybutanoic acid (CAS 2005454-12-4) is a chemical compound with the molecular formula C14H23N7O6 and a molecular weight of 385.38 g/mol. IUPAC name: (2S,3R)-2-[[(1S)-3-amino-3-oxo-1-(3-piperazin-1-yl-1,2,4-oxadiazol-5-yl)propyl]carbamoylamino]-3-hydroxybutanoic acid. InChIKey: RKAIKBRLPZSBRN-WEDXCCLWSA-N.
| Molecular formula | C14H23N7O6 |
|---|---|
| Molecular weight | 385.38 g/mol |
| IUPAC name | (2S,3R)-2-[[(1S)-3-amino-3-oxo-1-(3-piperazin-1-yl-1,2,4-oxadiazol-5-yl)propyl]carbamoylamino]-3-hydroxybutanoic acid |
| InChIKey | RKAIKBRLPZSBRN-WEDXCCLWSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NC(=O)N[C@@H](CC(=O)N)C1=NC(=NO1)N2CCNCC2)O |
Computed by PubChem (NCBI)