CAS 2005471-25-8 is the registry number for N-Methoxy-n-methyl-4-phenyl-3-(trifluoromethyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-methoxy-N-methyl-4-phenyl-3-(trifluoromethyl)benzamide (CAS 2005471-25-8) is a chemical compound with the molecular formula C16H14F3NO2 and a molecular weight of 309.28 g/mol. IUPAC name: N-methoxy-N-methyl-4-phenyl-3-(trifluoromethyl)benzamide. InChIKey: MVMDCZIURPTJEC-UHFFFAOYSA-N.
| Molecular formula | C16H14F3NO2 |
|---|---|
| Molecular weight | 309.28 g/mol |
| IUPAC name | N-methoxy-N-methyl-4-phenyl-3-(trifluoromethyl)benzamide |
| InChIKey | MVMDCZIURPTJEC-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=CC(=C(C=C1)C2=CC=CC=C2)C(F)(F)F)OC |
Computed by PubChem (NCBI)