CAS 20055-01-0 appears in our catalog under these names: 1-Methyl-1h-pyrazole-4,5-diamine sulfate, 95%, 1-Methyl-1H-pyrazole-4,5-diamine Sulfate, 1-Methyl-1H-pyrazole-4,5-diamine sulfate, 97%, 97%, 1-Methyl-1H-pyrazole-4,5-diamine sulfate, 97%. Offered by: Combi-blocks, TRC, Chemat, Ambeed. Available pack sizes: 5g, 10g, 250mg, 1g, 500mg, 100mg.
1-methylpyrazole-4,5-diamine;sulfuric acid (CAS 20055-01-0) is a chemical compound with the molecular formula C4H10N4O4S and a molecular weight of 210.21 g/mol. IUPAC name: 1-methylpyrazole-4,5-diamine;sulfuric acid. InChIKey: CIMLJTZGZLWBJY-UHFFFAOYSA-N.
| Molecular formula | C4H10N4O4S |
|---|---|
| Molecular weight | 210.21 g/mol |
| IUPAC name | 1-methylpyrazole-4,5-diamine;sulfuric acid |
| InChIKey | CIMLJTZGZLWBJY-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)N)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)