Products 2005680-14-6
CAS 2005680-14-6 appears in our catalog under these names: 5-(4-Bromo-3-methylphenyl)-1,3-oxazole, 95%, 5-(4-Bromo-3-methylphenyl)-1,3-oxazole. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
5-(4-bromo-3-methylphenyl)-1,3-oxazole (CAS 2005680-14-6) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: 5-(4-bromo-3-methylphenyl)-1,3-oxazole. InChIKey: GIIWIAUKFBOCBL-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 5-(4-bromo-3-methylphenyl)-1,3-oxazole |
| InChIKey | GIIWIAUKFBOCBL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CN=CO2)Br |
Computed by PubChem (NCBI)