CAS 200622-33-9 appears in our catalog under these names: Fmoc-d-gln-opfp, 95%, Fmoc–D–Gln–OPfp. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 25g.
(2,3,4,5,6-pentafluorophenyl) (2R)-5-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoate (CAS 200622-33-9) is a chemical compound with the molecular formula C26H19F5N2O5 and a molecular weight of 534.4 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) (2R)-5-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoate. InChIKey: FVJZFMYVWWIIGD-QGZVFWFLSA-N.
| Molecular formula | C26H19F5N2O5 |
|---|---|
| Molecular weight | 534.4 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) (2R)-5-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoate |
| InChIKey | FVJZFMYVWWIIGD-QGZVFWFLSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCC(=O)N)C(=O)OC4=C(C(=C(C(=C4F)F)F)F)F |
Computed by PubChem (NCBI)