CAS 2006276-93-1 appears in our catalog under these names: 2-Fluoro-4-morpholinoaniline Dihydrochloride, ≥95%, ≥95%, 2-FLUORO-4-MORPHOLINOANILINE DIHYDROCHLORIDE, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-fluoro-4-morpholin-4-ylaniline;dihydrochloride (CAS 2006276-93-1) is a chemical compound with the molecular formula C10H15Cl2FN2O and a molecular weight of 269.14 g/mol. IUPAC name: 2-fluoro-4-morpholin-4-ylaniline;dihydrochloride. InChIKey: XHUAOWGHYUIEMM-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2FN2O |
|---|---|
| Molecular weight | 269.14 g/mol |
| IUPAC name | 2-fluoro-4-morpholin-4-ylaniline;dihydrochloride |
| InChIKey | XHUAOWGHYUIEMM-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC(=C(C=C2)N)F.Cl.Cl |
Computed by PubChem (NCBI)