CAS 2006276-95-3 appears in our catalog under these names: Methyl 2,6-Dimethoxy-3-(methylsulfonyl)benzoate, ≥95%, ≥95%, Methyl 2,6-dimethoxy-3-(methylsulfonyl)benzoate, 95%. Offered by: Chemat, Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 2,6-dimethoxy-3-methylsulfonylbenzoate (CAS 2006276-95-3) is a chemical compound with the molecular formula C11H14O6S and a molecular weight of 274.29 g/mol. IUPAC name: methyl 2,6-dimethoxy-3-methylsulfonylbenzoate. InChIKey: IPVORZVNUODJSE-UHFFFAOYSA-N.
| Molecular formula | C11H14O6S |
|---|---|
| Molecular weight | 274.29 g/mol |
| IUPAC name | methyl 2,6-dimethoxy-3-methylsulfonylbenzoate |
| InChIKey | IPVORZVNUODJSE-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)S(=O)(=O)C)OC)C(=O)OC |
Computed by PubChem (NCBI)