CAS 200628-33-7 appears in our catalog under these names: Rasagiline Impurity 2, (R)-2,3-Dihydro-N-(phenylmethyl)-1H-Inden-1-amine Hydrochloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(1R)-N-benzyl-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 200628-33-7) is a chemical compound with the molecular formula C16H18ClN and a molecular weight of 259.77 g/mol. IUPAC name: (1R)-N-benzyl-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: OWIZYZJDRLPDDD-PKLMIRHRSA-N.
| Molecular formula | C16H18ClN |
|---|---|
| Molecular weight | 259.77 g/mol |
| IUPAC name | (1R)-N-benzyl-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | OWIZYZJDRLPDDD-PKLMIRHRSA-N |
| SMILES | C1CC2=CC=CC=C2[C@@H]1NCC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)