CAS 20064-98-6 appears in our catalog under these names: 3-Methyl-2-(methylthio)benzo(d)thiazol-3-ium iodide, 3-Methyl-2-(methylthio)benzo[d]thiazol-3-ium iodide 97%, 3-Methyl-2-(methylthio)benzo[d]thiazol-3-ium iodide, 97%, 97%, 3-METHYL-2-(METHYLTHIO)-BENZOTHIAZOLIUM IODIDE, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 2g, 250mg, 1g, 5g, 100mg.
3-methyl-2-methylsulfanyl-1,3-benzothiazol-3-ium iodide (CAS 20064-98-6) is a chemical compound with the molecular formula C9H10INS2 and a molecular weight of 323.2 g/mol. IUPAC name: 3-methyl-2-methylsulfanyl-1,3-benzothiazol-3-ium iodide. InChIKey: RKIVJTIIEWIWTN-UHFFFAOYSA-M.
| Molecular formula | C9H10INS2 |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | 3-methyl-2-methylsulfanyl-1,3-benzothiazol-3-ium iodide |
| InChIKey | RKIVJTIIEWIWTN-UHFFFAOYSA-M |
| SMILES | C[N+]1=C(SC2=CC=CC=C21)SC.[I-] |
Computed by PubChem (NCBI)