Products 2007142-71-2
CAS 2007142-71-2 is the registry number for 5-((4-Carboxy-2-methylphenyl)ethynyl)isophthalic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[2-(4-carboxy-2-methylphenyl)ethynyl]benzene-1,3-dicarboxylic acid (CAS 2007142-71-2) is a chemical compound with the molecular formula C18H12O6 and a molecular weight of 324.3 g/mol. IUPAC name: 5-[2-(4-carboxy-2-methylphenyl)ethynyl]benzene-1,3-dicarboxylic acid. InChIKey: SKSVRHCXVBDAEI-UHFFFAOYSA-N.
| Molecular formula | C18H12O6 |
|---|---|
| Molecular weight | 324.3 g/mol |
| IUPAC name | 5-[2-(4-carboxy-2-methylphenyl)ethynyl]benzene-1,3-dicarboxylic acid |
| InChIKey | SKSVRHCXVBDAEI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)O)C#CC2=CC(=CC(=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)