CAS 20074-76-4 appears in our catalog under these names: Copper(ii) acrylate, 95%, Copper(ii)acrylate, 95%, Copper(II) acrylate. Offered by: Combi-blocks, Chemat Brand, GLPBio. Available pack sizes: 5g, 500g, 100g, 25g, on request, 1g.
Copper bis(prop-2-enoate) (CAS 20074-76-4) is a chemical compound with the molecular formula C6H6CuO4 and a molecular weight of 205.66 g/mol. IUPAC name: copper bis(prop-2-enoate). InChIKey: XPLSDXJBKRIVFZ-UHFFFAOYSA-L.
| Molecular formula | C6H6CuO4 |
|---|---|
| Molecular weight | 205.66 g/mol |
| IUPAC name | copper bis(prop-2-enoate) |
| InChIKey | XPLSDXJBKRIVFZ-UHFFFAOYSA-L |
| SMILES | C=CC(=O)[O-].C=CC(=O)[O-].[Cu+2] |
Computed by PubChem (NCBI)