CAS 20077-09-2 is the registry number for 1-Bromothioxanthen-9-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-bromothioxanthen-9-one (CAS 20077-09-2) is a chemical compound with the molecular formula C13H7BrOS and a molecular weight of 291.16 g/mol. IUPAC name: 1-bromothioxanthen-9-one. InChIKey: WHSFSWJDZYZLNF-UHFFFAOYSA-N.
| Molecular formula | C13H7BrOS |
|---|---|
| Molecular weight | 291.16 g/mol |
| IUPAC name | 1-bromothioxanthen-9-one |
| InChIKey | WHSFSWJDZYZLNF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(S2)C=CC=C3Br |
Computed by PubChem (NCBI)