CAS 2007909-89-7 is the registry number for 3-Bromo-2-(4-chlorophenyl)-6,7-dihydropyrazolo(1,5-a)pyrazin-4(5H)-one, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
3-bromo-2-(4-chlorophenyl)-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one (CAS 2007909-89-7) is a chemical compound with the molecular formula C12H9BrClN3O and a molecular weight of 326.57 g/mol. IUPAC name: 3-bromo-2-(4-chlorophenyl)-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one. InChIKey: TUTSDONSDVUVJU-UHFFFAOYSA-N.
| Molecular formula | C12H9BrClN3O |
|---|---|
| Molecular weight | 326.57 g/mol |
| IUPAC name | 3-bromo-2-(4-chlorophenyl)-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one |
| InChIKey | TUTSDONSDVUVJU-UHFFFAOYSA-N |
| SMILES | C1CN2C(=C(C(=N2)C3=CC=C(C=C3)Cl)Br)C(=O)N1 |
Computed by PubChem (NCBI)