CAS 2007919-46-0 appears in our catalog under these names: Trans-3-oxabicyclo[3.1.0]hexane-6-methylamine hydrochloride, 95%, trans-3-oxabicyclo(3.1.0)hexane-6-methylamine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
[(1R,5S)-3-oxabicyclo[3.1.0]hexan-6-yl]methanamine;hydrochloride (CAS 2007919-46-0) is a chemical compound with the molecular formula C6H12ClNO and a molecular weight of 149.62 g/mol. IUPAC name: [(1R,5S)-3-oxabicyclo[3.1.0]hexan-6-yl]methanamine;hydrochloride. InChIKey: KSIVBRSOHYOUPY-DKECMWHCSA-N.
| Molecular formula | C6H12ClNO |
|---|---|
| Molecular weight | 149.62 g/mol |
| IUPAC name | [(1R,5S)-3-oxabicyclo[3.1.0]hexan-6-yl]methanamine;hydrochloride |
| InChIKey | KSIVBRSOHYOUPY-DKECMWHCSA-N |
| SMILES | C1[C@@H]2[C@@H](C2CN)CO1.Cl |
Computed by PubChem (NCBI)