CAS 2007920-76-3 is the registry number for Methyl 7,9-dibromo-4-oxo-4h-pyrido[1,2-a]pyrimidine-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Methyl 7,9-dibromo-4-oxopyrido[1,2-a]pyrimidine-2-carboxylate (CAS 2007920-76-3) is a chemical compound with the molecular formula C10H6Br2N2O3 and a molecular weight of 361.97 g/mol. IUPAC name: methyl 7,9-dibromo-4-oxopyrido[1,2-a]pyrimidine-2-carboxylate. InChIKey: UOHSBTKWCYXDNW-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2N2O3 |
|---|---|
| Molecular weight | 361.97 g/mol |
| IUPAC name | methyl 7,9-dibromo-4-oxopyrido[1,2-a]pyrimidine-2-carboxylate |
| InChIKey | UOHSBTKWCYXDNW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=O)N2C=C(C=C(C2=N1)Br)Br |
Computed by PubChem (NCBI)