CAS 2007921-27-7 appears in our catalog under these names: 4,7-Dibromo-6-fluoro-2,3-dihydro-1h-indol-2-one, 95%, 4,7-Dibromo-6-fluoroindolin-2-one, 97%, 4,7-dibromo-6-fluoro-2,3-dihydro-1H-indol-2-one, 97%, 97%, 4,7-dibromo-6-fluoro-2,3-dihydro-1H-indol-2-one, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg, 500mg.
4,7-dibromo-6-fluoro-1,3-dihydroindol-2-one (CAS 2007921-27-7) is a chemical compound with the molecular formula C8H4Br2FNO and a molecular weight of 308.93 g/mol. IUPAC name: 4,7-dibromo-6-fluoro-1,3-dihydroindol-2-one. InChIKey: XMJZAYJDPGGMTJ-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2FNO |
|---|---|
| Molecular weight | 308.93 g/mol |
| IUPAC name | 4,7-dibromo-6-fluoro-1,3-dihydroindol-2-one |
| InChIKey | XMJZAYJDPGGMTJ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C(=C2NC1=O)Br)F)Br |
Computed by PubChem (NCBI)