CAS 2008006-36-6 appears in our catalog under these names: BFF–816, BFF-816, 98.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 10 mg, 25 mg, 5 mg, 50 mg.
(5Z)-5-[[3-(11-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-7-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (CAS 2008006-36-6) is a chemical compound with the molecular formula C21H16N2O3S and a molecular weight of 376.4 g/mol. IUPAC name: (5Z)-5-[[3-(11-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-7-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione. InChIKey: CGUAICJZQHKUOC-BOPFTXTBSA-N.
| Molecular formula | C21H16N2O3S |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | (5Z)-5-[[3-(11-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-7-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| InChIKey | CGUAICJZQHKUOC-BOPFTXTBSA-N |
| SMILES | C1CC(=O)N2CCC3=C2C1=C(C=C3)C4=CC=CC(=C4)/C=C\5/C(=O)NC(=O)S5 |
Computed by PubChem (NCBI)