CAS 20083-38-9 appears in our catalog under these names: Pentafluorophenyltrichlorosilane, Trichloro(Pentafluorophenyl)Silane. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 0,25g.
Trichloro-(2,3,4,5,6-pentafluorophenyl)silane (CAS 20083-38-9) is a chemical compound with the molecular formula C6Cl3F5Si and a molecular weight of 301.5 g/mol. IUPAC name: trichloro-(2,3,4,5,6-pentafluorophenyl)silane. InChIKey: QUJHWGZPSFBJAP-UHFFFAOYSA-N.
| Molecular formula | C6Cl3F5Si |
|---|---|
| Molecular weight | 301.5 g/mol |
| IUPAC name | trichloro-(2,3,4,5,6-pentafluorophenyl)silane |
| InChIKey | QUJHWGZPSFBJAP-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)[Si](Cl)(Cl)Cl)F)F)F |
Computed by PubChem (NCBI)