Products 2008714-26-7
CAS 2008714-26-7 is the registry number for tert-butyl (3S,4S)-3-(hydroxymethyl)-4-(trifluoromethyl)pyrrolidine-1-carboxylate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl (3S,4S)-3-(hydroxymethyl)-4-(trifluoromethyl)pyrrolidine-1-carboxylate (CAS 2008714-26-7) is a chemical compound with the molecular formula C11H18F3NO3 and a molecular weight of 269.26 g/mol. IUPAC name: tert-butyl (3S,4S)-3-(hydroxymethyl)-4-(trifluoromethyl)pyrrolidine-1-carboxylate. InChIKey: GXFXYRPLLNFRNI-JGVFFNPUSA-N.
| Molecular formula | C11H18F3NO3 |
|---|---|
| Molecular weight | 269.26 g/mol |
| IUPAC name | tert-butyl (3S,4S)-3-(hydroxymethyl)-4-(trifluoromethyl)pyrrolidine-1-carboxylate |
| InChIKey | GXFXYRPLLNFRNI-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@@H](C1)C(F)(F)F)CO |
Computed by PubChem (NCBI)