CAS 2009-97-4 appears in our catalog under these names: ethyl 2-diazo-3-oxobutanoate, 97%, Ethyl diazoacetoacetate, Ethyl 2-diazoacetoacetate, 98%, 98%. Offered by: Fluorochem, GLPBio, Chemat. Available pack sizes: 100mg, 1g, 5g, 10g, 25g, 100g, 250g, 500g.
Ethyl 2-diazo-3-oxobutanoate (CAS 2009-97-4) is a chemical compound with the molecular formula C6H8N2O3 and a molecular weight of 156.14 g/mol. IUPAC name: ethyl 2-diazo-3-oxobutanoate. InChIKey: JWTPSIXYXYNAOU-UHFFFAOYSA-N.
| Molecular formula | C6H8N2O3 |
|---|---|
| Molecular weight | 156.14 g/mol |
| IUPAC name | ethyl 2-diazo-3-oxobutanoate |
| InChIKey | JWTPSIXYXYNAOU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=[N+]=[N-])C(=O)C |
Computed by PubChem (NCBI)