CAS 201046-59-5 appears in our catalog under these names: Fmoc–Orn(Fmoc)–OH, Fmoc-L-Orn(Fmoc)-OH, Fmoc-Orn(Fmoc)-OH 95%, Fmoc-Orn(Fmoc)-OH, 95%, 95%, Fmoc-Orn(Fmoc)-OH, 98%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 250mg, 10g, 100g, 50g.
(2S)-2,5-bis(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (CAS 201046-59-5) is a chemical compound with the molecular formula C35H32N2O6 and a molecular weight of 576.6 g/mol. IUPAC name: (2S)-2,5-bis(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid. InChIKey: HFKOCIWEYMAENQ-YTTGMZPUSA-N.
| Molecular formula | C35H32N2O6 |
|---|---|
| Molecular weight | 576.6 g/mol |
| IUPAC name | (2S)-2,5-bis(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| InChIKey | HFKOCIWEYMAENQ-YTTGMZPUSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCC[C@@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)