CAS 20109-57-3 appears in our catalog under these names: Dodecafluoroheptyl thacrylate, 2,3,4,5,5,5-Hexafluoro-2,4-bis(trifluoromethyl)pentyl acrylate. Offered by: GLPBio, Chemat. Available pack sizes: 100g, 25g, 500g.
[2,3,4,5,5,5-hexafluoro-2,4-bis(trifluoromethyl)pentyl] prop-2-enoate (CAS 20109-57-3) is a chemical compound with the molecular formula C10H6F12O2 and a molecular weight of 386.13 g/mol. IUPAC name: [2,3,4,5,5,5-hexafluoro-2,4-bis(trifluoromethyl)pentyl] prop-2-enoate. InChIKey: SQPVWJZAHUFSJY-UHFFFAOYSA-N.
| Molecular formula | C10H6F12O2 |
|---|---|
| Molecular weight | 386.13 g/mol |
| IUPAC name | [2,3,4,5,5,5-hexafluoro-2,4-bis(trifluoromethyl)pentyl] prop-2-enoate |
| InChIKey | SQPVWJZAHUFSJY-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCC(C(C(C(F)(F)F)(C(F)(F)F)F)F)(C(F)(F)F)F |
Computed by PubChem (NCBI)