Products 201206-00-0

CAS 201206-00-0 is the registry number for Z-D-Pro-OtBu, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g.

Structural formula: {0} (CAS {1})

1-O-benzyl 2-O-tert-butyl (2R)-pyrrolidine-1,2-dicarboxylate (CAS 201206-00-0) is a chemical compound with the molecular formula C17H23NO4 and a molecular weight of 305.4 g/mol. IUPAC name: 1-O-benzyl 2-O-tert-butyl (2R)-pyrrolidine-1,2-dicarboxylate. InChIKey: OULMZZGGALAOLR-CQSZACIVSA-N.

Identity
Molecular formulaC17H23NO4
Molecular weight305.4 g/mol
IUPAC name1-O-benzyl 2-O-tert-butyl (2R)-pyrrolidine-1,2-dicarboxylate
InChIKeyOULMZZGGALAOLR-CQSZACIVSA-N
SMILESCC(C)(C)OC(=O)[C@H]1CCCN1C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)