CAS 2013784-31-9 is the registry number for (5-Amino-pyridin-2-yl)-(3,3-difluoro-pyrrolidin-1-yl)-methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(5-amino-2-pyridinyl)-(3,3-difluoropyrrolidin-1-yl)methanone (CAS 2013784-31-9) is a chemical compound with the molecular formula C10H11F2N3O and a molecular weight of 227.21 g/mol. IUPAC name: (5-amino-2-pyridinyl)-(3,3-difluoropyrrolidin-1-yl)methanone. InChIKey: NWHVQGJNOPALLP-UHFFFAOYSA-N.
| Molecular formula | C10H11F2N3O |
|---|---|
| Molecular weight | 227.21 g/mol |
| IUPAC name | (5-amino-2-pyridinyl)-(3,3-difluoropyrrolidin-1-yl)methanone |
| InChIKey | NWHVQGJNOPALLP-UHFFFAOYSA-N |
| SMILES | C1CN(CC1(F)F)C(=O)C2=NC=C(C=C2)N |
Computed by PubChem (NCBI)