CAS 201419-80-9 appears in our catalog under these names: 2,4,8,10-Tetraoxa-3,9-dithiaspiro[5.5]undecane 3,3,9,9-Tetraoxide, >95.0%(qNMR), 2,4,8,10-Tetraoxa-3,9-dithiaspiro[5.5]undecane 3,3,9,9-tetraoxide, 95.0%, 95.0%. Offered by: TCI, Chemat. Available pack sizes: 1g, 5g.
2,4,8,10-tetraoxa-3lambda6,9lambda6-dithiaspiro[5.5]undecane 3,3,9,9-tetraoxide (CAS 201419-80-9) is a chemical compound with the molecular formula C5H8O8S2 and a molecular weight of 260.2 g/mol. IUPAC name: 2,4,8,10-tetraoxa-3lambda6,9lambda6-dithiaspiro[5.5]undecane 3,3,9,9-tetraoxide. InChIKey: YHTPVDJKWQQLPM-UHFFFAOYSA-N.
| Molecular formula | C5H8O8S2 |
|---|---|
| Molecular weight | 260.2 g/mol |
| IUPAC name | 2,4,8,10-tetraoxa-3lambda6,9lambda6-dithiaspiro[5.5]undecane 3,3,9,9-tetraoxide |
| InChIKey | YHTPVDJKWQQLPM-UHFFFAOYSA-N |
| SMILES | C1C2(COS(=O)(=O)O1)COS(=O)(=O)OC2 |
Computed by PubChem (NCBI)