CAS 201484-26-6 appears in our catalog under these names: Fmoc-3,5-dibromo-tyr-oh, 98%, Fmoc–3,5–dibromo–Tyr–OH, Fmoc-3,5-Dibromo-L-Tyr-OH 98%, Fmoc-3,5-dibromo-tyr-oh, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 25g, 5g, 250mg, 10g.
(2S)-3-(3,5-dibromo-4-hydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 201484-26-6) is a chemical compound with the molecular formula C24H19Br2NO5 and a molecular weight of 561.2 g/mol. IUPAC name: (2S)-3-(3,5-dibromo-4-hydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: DGAVNNURVZYVLW-NRFANRHFSA-N.
| Molecular formula | C24H19Br2NO5 |
|---|---|
| Molecular weight | 561.2 g/mol |
| IUPAC name | (2S)-3-(3,5-dibromo-4-hydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | DGAVNNURVZYVLW-NRFANRHFSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC(=C(C(=C4)Br)O)Br)C(=O)O |
Computed by PubChem (NCBI)