CAS 201485-38-3 appears in our catalog under these names: Fmoc-D-hcit-OH, 97%, Fmoc–D–Homocit–OH, Fmoc-D-HCit-OH, Fmoc-D-HoCit-OH 98%, Fmoc-D-Hcit-OH, 98%, 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 10g, 25g, 1g, 5g, 100mg, 250mg.
(2R)-6-(carbamoylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 201485-38-3) is a chemical compound with the molecular formula C22H25N3O5 and a molecular weight of 411.5 g/mol. IUPAC name: (2R)-6-(carbamoylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: VJZUCXPETVPQIB-LJQANCHMSA-N.
| Molecular formula | C22H25N3O5 |
|---|---|
| Molecular weight | 411.5 g/mol |
| IUPAC name | (2R)-6-(carbamoylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| InChIKey | VJZUCXPETVPQIB-LJQANCHMSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCCCNC(=O)N)C(=O)O |
Computed by PubChem (NCBI)