CAS 201541-53-9 appears in our catalog under these names: Fluvastatin sodium salt hydrate, 95%, Fluvastatin sodium salt hydrate, Fluvastatin (sodium monohydrate). Offered by: Combi-blocks, Biosynth, MedChemExpress. Available pack sizes: 1g, 5g, 25g, 10g, Get quote.
Sodium;(E,3S,5R)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate;hydrate (CAS 201541-53-9) is a chemical compound with the molecular formula C24H27FNNaO5 and a molecular weight of 451.5 g/mol. IUPAC name: sodium;(E,3S,5R)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate;hydrate. InChIKey: KKEMYLLTGGQWCE-FFAWTJJMSA-M.
| Molecular formula | C24H27FNNaO5 |
|---|---|
| Molecular weight | 451.5 g/mol |
| IUPAC name | sodium;(E,3S,5R)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate;hydrate |
| InChIKey | KKEMYLLTGGQWCE-FFAWTJJMSA-M |
| SMILES | CC(C)N1C2=CC=CC=C2C(=C1/C=C/[C@@H](C[C@@H](CC(=O)[O-])O)O)C3=CC=C(C=C3)F.O.[Na+] |
Computed by PubChem (NCBI)