CAS 2015585-89-2 is the registry number for [5-(3-Chloro-phenyl)-thiophen-2-yl]-methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[5-(3-chlorophenyl)thiophen-2-yl]methanol (CAS 2015585-89-2) is a chemical compound with the molecular formula C11H9ClOS and a molecular weight of 224.71 g/mol. IUPAC name: [5-(3-chlorophenyl)thiophen-2-yl]methanol. InChIKey: FXFPFDDLYGMYLS-UHFFFAOYSA-N.
| Molecular formula | C11H9ClOS |
|---|---|
| Molecular weight | 224.71 g/mol |
| IUPAC name | [5-(3-chlorophenyl)thiophen-2-yl]methanol |
| InChIKey | FXFPFDDLYGMYLS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CC=C(S2)CO |
Computed by PubChem (NCBI)