Products 201593-85-3
CAS 201593-85-3 is the registry number for Insecticidal agent 2. Offered by: MedChemExpress. Available pack sizes: 25 mg, 50 mg, 100 mg, 250 mg, 5 mg, 10 mg.
N-[[2-chloro-3,5-bis(trifluoromethyl)phenyl]carbamoyl]-2-fluorobenzamide (CAS 201593-85-3) is a chemical compound with the molecular formula C16H8ClF7N2O2 and a molecular weight of 428.69 g/mol. IUPAC name: N-[[2-chloro-3,5-bis(trifluoromethyl)phenyl]carbamoyl]-2-fluorobenzamide. InChIKey: RYQUQFILGZVMAB-UHFFFAOYSA-N.
| Molecular formula | C16H8ClF7N2O2 |
|---|---|
| Molecular weight | 428.69 g/mol |
| IUPAC name | N-[[2-chloro-3,5-bis(trifluoromethyl)phenyl]carbamoyl]-2-fluorobenzamide |
| InChIKey | RYQUQFILGZVMAB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC(=O)NC2=CC(=CC(=C2Cl)C(F)(F)F)C(F)(F)F)F |
Computed by PubChem (NCBI)