CAS 201595-69-9 is the registry number for L-Lactate-13C (sodium) (20% in water), 98.00%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 10 mg, 100 mg, 5 mg, 25 mg.
CAS 201595-69-9 identifies a chemical compound with the molecular formula C3H6NaO3 and a molecular weight of 114.06 g/mol. InChIKey: ZZUUMCMLIPRDPI-FWGDTYFGSA-N.
| Molecular formula | C3H6NaO3 |
|---|---|
| Molecular weight | 114.06 g/mol |
| InChIKey | ZZUUMCMLIPRDPI-FWGDTYFGSA-N |
| SMILES | C[C@@H]([13C](=O)O)O.[Na] |
Computed by PubChem (NCBI)