CAS 201667-53-0 appears in our catalog under these names: 3-Aminopropyl beta-d-galactopyranoside, 95%, 3-Aminopropyl β-D-galactopyranoside. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 5g, 1g, 100mg, 50mg, 500mg, 1000mg.
(2R,3R,4S,5R,6R)-2-(3-aminopropoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 201667-53-0) is a chemical compound with the molecular formula C9H19NO6 and a molecular weight of 237.25 g/mol. IUPAC name: (2R,3R,4S,5R,6R)-2-(3-aminopropoxy)-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: ATNZYMLQVJTLPA-QMGXLNLGSA-N.
| Molecular formula | C9H19NO6 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | (2R,3R,4S,5R,6R)-2-(3-aminopropoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | ATNZYMLQVJTLPA-QMGXLNLGSA-N |
| SMILES | C(CN)CO[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)