Products 20167-21-9
CAS 20167-21-9 appears in our catalog under these names: Glutathione sodium, Reduced glutathione sodium, L-Glutathione reduced (monosodium), Reduced glutathione sodium, 10 g, Reduced glutathione sodium, 25 g. Offered by: TargetMol, Biosynth, MedChemExpress, Roth, Chemat. Available pack sizes: 25mg, 50mg, 100mg, 25g, 10g, 50g, 100g, 250g.
Sodium 2-[[(2R)-2-[[(4S)-4-amino-4-carboxybutanoyl]amino]-3-sulfanylpropanoyl]amino]acetate (CAS 20167-21-9) is a chemical compound with the molecular formula C10H16N3NaO6S and a molecular weight of 329.31 g/mol. IUPAC name: sodium 2-[[(2R)-2-[[(4S)-4-amino-4-carboxybutanoyl]amino]-3-sulfanylpropanoyl]amino]acetate. InChIKey: QWXDICNEPRTOLR-GEMLJDPKSA-M.
| Molecular formula | C10H16N3NaO6S |
|---|---|
| Molecular weight | 329.31 g/mol |
| IUPAC name | sodium 2-[[(2R)-2-[[(4S)-4-amino-4-carboxybutanoyl]amino]-3-sulfanylpropanoyl]amino]acetate |
| InChIKey | QWXDICNEPRTOLR-GEMLJDPKSA-M |
| SMILES | C(CC(=O)N[C@@H](CS)C(=O)NCC(=O)[O-])[C@@H](C(=O)O)N.[Na+] |
Computed by PubChem (NCBI)