Products 201789-28-8

CAS 201789-28-8 is the registry number for 2,4-Bis(trifluoromethyl)phenylacetonitrile, 97%. Offered by: Combi-blocks. Available pack sizes: 100g, 10g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

2-[2,4-bis(trifluoromethyl)phenyl]acetonitrile (CAS 201789-28-8) is a chemical compound with the molecular formula C10H5F6N and a molecular weight of 253.14 g/mol. IUPAC name: 2-[2,4-bis(trifluoromethyl)phenyl]acetonitrile. InChIKey: BJEJFFSIEUOCNS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H5F6N
Molecular weight253.14 g/mol
IUPAC name2-[2,4-bis(trifluoromethyl)phenyl]acetonitrile
InChIKeyBJEJFFSIEUOCNS-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(F)(F)F)C(F)(F)F)CC#N

Computed by PubChem (NCBI)