CAS 201789-28-8 is the registry number for 2,4-Bis(trifluoromethyl)phenylacetonitrile, 97%. Offered by: Combi-blocks. Available pack sizes: 100g, 10g, 5g, 25g, 1g.
2-[2,4-bis(trifluoromethyl)phenyl]acetonitrile (CAS 201789-28-8) is a chemical compound with the molecular formula C10H5F6N and a molecular weight of 253.14 g/mol. IUPAC name: 2-[2,4-bis(trifluoromethyl)phenyl]acetonitrile. InChIKey: BJEJFFSIEUOCNS-UHFFFAOYSA-N.
| Molecular formula | C10H5F6N |
|---|---|
| Molecular weight | 253.14 g/mol |
| IUPAC name | 2-[2,4-bis(trifluoromethyl)phenyl]acetonitrile |
| InChIKey | BJEJFFSIEUOCNS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(F)(F)F)CC#N |
Computed by PubChem (NCBI)