CAS 201802-29-1 appears in our catalog under these names: (4-(Bis(4-methoxyphenyl)amino)phenyl)boronic Acid (contains varying amounts of Anhydride), [4-[Bis(4-methoxyphenyl)amino]phenyl]boronic Acid (contains varying amounts of Anhydride), (4-(Bis(4-methoxyphenyl)amino)phenyl)boronic acid, 97%, 97%, (4-(Bis(4-methoxyphenyl)amino)phenyl)boronic acid, 95%, (4-(Bis(4-methoxyphenyl)amino)phenyl)boronic acid, 97%. Offered by: Biosynth, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 2000mg, 1g, 250mg, 500mg, 1000mg, 5000mg, 15g, 100mg.
[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]boronic acid (CAS 201802-29-1) is a chemical compound with the molecular formula C20H20BNO4 and a molecular weight of 349.2 g/mol. IUPAC name: [4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]boronic acid. InChIKey: HDVVFJKYLNSKOG-UHFFFAOYSA-N.
| Molecular formula | C20H20BNO4 |
|---|---|
| Molecular weight | 349.2 g/mol |
| IUPAC name | [4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]boronic acid |
| InChIKey | HDVVFJKYLNSKOG-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N(C2=CC=C(C=C2)OC)C3=CC=C(C=C3)OC)(O)O |
Computed by PubChem (NCBI)