CAS 201851-33-4 appears in our catalog under these names: 9-(Iodomethyl)-9h-xanthene, 95%, 9–(iodomethyl)–9H–xanthene, 9-(iodomethyl)-9H-xanthene. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
9-(iodomethyl)-9H-xanthene (CAS 201851-33-4) is a chemical compound with the molecular formula C14H11IO and a molecular weight of 322.14 g/mol. IUPAC name: 9-(iodomethyl)-9H-xanthene. InChIKey: MEVPAWYPDVSDLL-UHFFFAOYSA-N.
| Molecular formula | C14H11IO |
|---|---|
| Molecular weight | 322.14 g/mol |
| IUPAC name | 9-(iodomethyl)-9H-xanthene |
| InChIKey | MEVPAWYPDVSDLL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C3O2)CI |
Computed by PubChem (NCBI)