CAS 201861-91-8 appears in our catalog under these names: 4,4'-Diiodo-trans-stilbene, 95%, 4,4'-Diiodo-trans-stilbene, >97.0%(GC), 4,4'-Diiodo-trans-stilbene, ≥97%, ≥97%, 4,4'-DIIODO-TRANS-STILBENE, 97%. Offered by: Combi-blocks, TCI, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 200mg.
1-iodo-4-[(E)-2-(4-iodophenyl)ethenyl]benzene (CAS 201861-91-8) is a chemical compound with the molecular formula C14H10I2 and a molecular weight of 432.04 g/mol. IUPAC name: 1-iodo-4-[(E)-2-(4-iodophenyl)ethenyl]benzene. InChIKey: BYEYAZGFUKIZPM-OWOJBTEDSA-N.
| Molecular formula | C14H10I2 |
|---|---|
| Molecular weight | 432.04 g/mol |
| IUPAC name | 1-iodo-4-[(E)-2-(4-iodophenyl)ethenyl]benzene |
| InChIKey | BYEYAZGFUKIZPM-OWOJBTEDSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C2=CC=C(C=C2)I)I |
Computed by PubChem (NCBI)