CAS 20189-08-6 appears in our catalog under these names: 2-Methoxy-4-methylphenol-3,5,6-d3,OD, 2-Methoxy-4-methylphenol-3,5,6-d3,OD, 98 atom % D, min 98% Chemical Purity, Creosol-d4. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 1g, 0,5g, 50 mg, 10 mg, 100 mg.
1,2,5-trideuterio-3-deuteriooxy-4-methoxy-6-methylbenzene (CAS 20189-08-6) is a chemical compound with the molecular formula C8H10O2 and a molecular weight of 142.19 g/mol. IUPAC name: 1,2,5-trideuterio-3-deuteriooxy-4-methoxy-6-methylbenzene. InChIKey: PETRWTHZSKVLRE-NKWHLQRWSA-N.
| Molecular formula | C8H10O2 |
|---|---|
| Molecular weight | 142.19 g/mol |
| IUPAC name | 1,2,5-trideuterio-3-deuteriooxy-4-methoxy-6-methylbenzene |
| InChIKey | PETRWTHZSKVLRE-NKWHLQRWSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C)[2H])OC)O[2H])[2H] |
Computed by PubChem (NCBI)