CAS 201988-63-8 is the registry number for Bz-Tyr-betaNA. Offered by: Creative Peptides. Available pack sizes: 250mg, 1g.
N-[(2S)-3-(4-hydroxyphenyl)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl]benzamide (CAS 201988-63-8) is a chemical compound with the molecular formula C26H22N2O3 and a molecular weight of 410.5 g/mol. IUPAC name: N-[(2S)-3-(4-hydroxyphenyl)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl]benzamide. InChIKey: NKRNJRQKVLUQKQ-DEOSSOPVSA-N.
| Molecular formula | C26H22N2O3 |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | N-[(2S)-3-(4-hydroxyphenyl)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl]benzamide |
| InChIKey | NKRNJRQKVLUQKQ-DEOSSOPVSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N[C@@H](CC2=CC=C(C=C2)O)C(=O)NC3=CC4=CC=CC=C4C=C3 |
Computed by PubChem (NCBI)