Products 201990-25-2

CAS 201990-25-2 is the registry number for S-(1,1-Dioxothiolan-3-yl) ethanethioate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

S-(1,1-dioxothiolan-3-yl) ethanethioate (CAS 201990-25-2) is a chemical compound with the molecular formula C6H10O3S2 and a molecular weight of 194.3 g/mol. IUPAC name: S-(1,1-dioxothiolan-3-yl) ethanethioate. InChIKey: XPQLUHYRXBWTNL-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10O3S2
Molecular weight194.3 g/mol
IUPAC nameS-(1,1-dioxothiolan-3-yl) ethanethioate
InChIKeyXPQLUHYRXBWTNL-UHFFFAOYSA-N
SMILESCC(=O)SC1CCS(=O)(=O)C1

Computed by PubChem (NCBI)