CAS 201992-75-8 is the registry number for 2,4-Di(adamantan-1-yl)thiazole, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2,4-bis(1-adamantyl)-1,3-thiazole (CAS 201992-75-8) is a chemical compound with the molecular formula C23H31NS and a molecular weight of 353.6 g/mol. IUPAC name: 2,4-bis(1-adamantyl)-1,3-thiazole. InChIKey: SIZXQCBNNFYZNH-UHFFFAOYSA-N.
| Molecular formula | C23H31NS |
|---|---|
| Molecular weight | 353.6 g/mol |
| IUPAC name | 2,4-bis(1-adamantyl)-1,3-thiazole |
| InChIKey | SIZXQCBNNFYZNH-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C4=CSC(=N4)C56CC7CC(C5)CC(C7)C6 |
Computed by PubChem (NCBI)