CAS 201996-39-6 is the registry number for Phosphoenolpyruvic acid (potassium)-13C2, 97.00%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 1 mg, 5 mg.
CAS 201996-39-6 identifies a chemical compound with the molecular formula C3H5KO6P and a molecular weight of 209.13 g/mol. InChIKey: RJPINWGLSYHRIW-AWQJXPNKSA-N.
| Molecular formula | C3H5KO6P |
|---|---|
| Molecular weight | 209.13 g/mol |
| InChIKey | RJPINWGLSYHRIW-AWQJXPNKSA-N |
| SMILES | [13CH2]=[13C](C(=O)O)OP(=O)(O)O.[K] |
Computed by PubChem (NCBI)