Products 2020003-64-7
CAS 2020003-64-7 is the registry number for Methyl 3-bromo-1H-thieno(3,2-c)pyrazole-5-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
Methyl 3-bromo-2H-thieno[3,2-c]pyrazole-5-carboxylate (CAS 2020003-64-7) is a chemical compound with the molecular formula C7H5BrN2O2S and a molecular weight of 261.10 g/mol. IUPAC name: methyl 3-bromo-2H-thieno[3,2-c]pyrazole-5-carboxylate. InChIKey: ICMIQWAONPVGQQ-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O2S |
|---|---|
| Molecular weight | 261.10 g/mol |
| IUPAC name | methyl 3-bromo-2H-thieno[3,2-c]pyrazole-5-carboxylate |
| InChIKey | ICMIQWAONPVGQQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=NNC(=C2S1)Br |
Computed by PubChem (NCBI)