Products 2020357-32-6
CAS 2020357-32-6 is the registry number for BChE-IN-23. Offered by: MedChemExpress. Available pack sizes: Get quote.
9-fluoro-6-(2-phenylethyl)-2,3,4,5-tetrahydroazepino[4,3-b]indol-1-one (CAS 2020357-32-6) is a chemical compound with the molecular formula C20H19FN2O and a molecular weight of 322.4 g/mol. IUPAC name: 9-fluoro-6-(2-phenylethyl)-2,3,4,5-tetrahydroazepino[4,3-b]indol-1-one. InChIKey: CCBXYVOCHXEAGU-UHFFFAOYSA-N.
| Molecular formula | C20H19FN2O |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 9-fluoro-6-(2-phenylethyl)-2,3,4,5-tetrahydroazepino[4,3-b]indol-1-one |
| InChIKey | CCBXYVOCHXEAGU-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C3=C(N2CCC4=CC=CC=C4)C=CC(=C3)F)C(=O)NC1 |
Computed by PubChem (NCBI)
Synonyms:
BChE-IN-23, orb2566869