CAS 2020375-99-7 is the registry number for (S)-Quinuclidin-3-yl-2-hydroxy-2,2-di(thiophen-2-yl)acetate. Offered by: TRC. Available pack sizes: 750mg.
[(3S)-1-azabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate (CAS 2020375-99-7) is a chemical compound with the molecular formula C17H19NO3S2 and a molecular weight of 349.5 g/mol. IUPAC name: [(3S)-1-azabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate. InChIKey: GYDFTKNRHZMENP-CYBMUJFWSA-N.
| Molecular formula | C17H19NO3S2 |
|---|---|
| Molecular weight | 349.5 g/mol |
| IUPAC name | [(3S)-1-azabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
| InChIKey | GYDFTKNRHZMENP-CYBMUJFWSA-N |
| SMILES | C1CN2CCC1[C@@H](C2)OC(=O)C(C3=CC=CS3)(C4=CC=CS4)O |
Computed by PubChem (NCBI)