CAS 2020402-43-9 appears in our catalog under these names: 4,4'-(2,5-Dibromo-1,4-phenylene)dipyridine, 97%, 4,4'-(2,5-Dibromo-1,4-phenylene)dipyridine, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg.
4-(2,5-dibromo-4-pyridin-4-ylphenyl)pyridine (CAS 2020402-43-9) is a chemical compound with the molecular formula C16H10Br2N2 and a molecular weight of 390.07 g/mol. IUPAC name: 4-(2,5-dibromo-4-pyridin-4-ylphenyl)pyridine. InChIKey: PQFVIWWYDZQDFI-UHFFFAOYSA-N.
| Molecular formula | C16H10Br2N2 |
|---|---|
| Molecular weight | 390.07 g/mol |
| IUPAC name | 4-(2,5-dibromo-4-pyridin-4-ylphenyl)pyridine |
| InChIKey | PQFVIWWYDZQDFI-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=CC(=C(C=C2Br)C3=CC=NC=C3)Br |
Computed by PubChem (NCBI)