CAS 202114-62-3 is the registry number for L-Glutamic acid-13C5 (hydrate salt). Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 50 mg, 5 mg.
Sodium;(2S)-2-amino-5-hydroxy-5-oxo(1,2,3,4,5-13C5)pentanoate;hydrate (CAS 202114-62-3) is a chemical compound with the molecular formula C5H10NNaO5 and a molecular weight of 192.09 g/mol. IUPAC name: sodium;(2S)-2-amino-5-hydroxy-5-oxo(1,2,3,4,5-13C5)pentanoate;hydrate. InChIKey: GJBHGUUFMNITCI-SUAQCYARSA-M.
| Molecular formula | C5H10NNaO5 |
|---|---|
| Molecular weight | 192.09 g/mol |
| IUPAC name | sodium;(2S)-2-amino-5-hydroxy-5-oxo(1,2,3,4,5-13C5)pentanoate;hydrate |
| InChIKey | GJBHGUUFMNITCI-SUAQCYARSA-M |
| SMILES | [13CH2]([13CH2][13C](=O)O)[13C@@H]([13C](=O)[O-])N.O.[Na+] |
Computed by PubChem (NCBI)