CAS 2021236-33-7 is the registry number for (6-Bromoimidazo[1,5-a]pyridin-5-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(6-bromoimidazo[1,5-a]pyridin-5-yl)methanol (CAS 2021236-33-7) is a chemical compound with the molecular formula C8H7BrN2O and a molecular weight of 227.06 g/mol. IUPAC name: (6-bromoimidazo[1,5-a]pyridin-5-yl)methanol. InChIKey: YPEGVUSTMDUQLL-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O |
|---|---|
| Molecular weight | 227.06 g/mol |
| IUPAC name | (6-bromoimidazo[1,5-a]pyridin-5-yl)methanol |
| InChIKey | YPEGVUSTMDUQLL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N2C1=CN=C2)CO)Br |
Computed by PubChem (NCBI)