CAS 202196-46-1 appears in our catalog under these names: Lapatinib Impurity 31, Lapatinib Impurity 17. Offered by: Chemat Brand. Available pack sizes: on request.
5-[4-(4-phenylmethoxyanilino)quinazolin-6-yl]furan-2-carbaldehyde (CAS 202196-46-1) is a chemical compound with the molecular formula C26H19N3O3 and a molecular weight of 421.4 g/mol. IUPAC name: 5-[4-(4-phenylmethoxyanilino)quinazolin-6-yl]furan-2-carbaldehyde. InChIKey: BIJFAHQDVZZUBO-UHFFFAOYSA-N.
| Molecular formula | C26H19N3O3 |
|---|---|
| Molecular weight | 421.4 g/mol |
| IUPAC name | 5-[4-(4-phenylmethoxyanilino)quinazolin-6-yl]furan-2-carbaldehyde |
| InChIKey | BIJFAHQDVZZUBO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)NC3=NC=NC4=C3C=C(C=C4)C5=CC=C(O5)C=O |
Computed by PubChem (NCBI)