Products 2022178-63-6
CAS 2022178-63-6 appears in our catalog under these names: δ8–THCBA–A (exempt preparation), δ8–THCBA–A, Δ8-THCBA-A. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg, 5 mg.
(6aR,10aR)-3-butyl-1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromene-2-carboxylic acid (CAS 2022178-63-6) is a chemical compound with the molecular formula C21H28O4 and a molecular weight of 344.4 g/mol. IUPAC name: (6aR,10aR)-3-butyl-1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromene-2-carboxylic acid. InChIKey: OGRPHJSTMJJKLP-HUUCEWRRSA-N.
| Molecular formula | C21H28O4 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | (6aR,10aR)-3-butyl-1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromene-2-carboxylic acid |
| InChIKey | OGRPHJSTMJJKLP-HUUCEWRRSA-N |
| SMILES | CCCCC1=CC2=C([C@@H]3CC(=CC[C@H]3C(O2)(C)C)C)C(=C1C(=O)O)O |
Computed by PubChem (NCBI)